C23H27N5 — CID 92581864
(2R,6R)-4-[(3S)-3-phenylbutyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 92581864) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is (2R,6R)-4-[(3S)-3-phenylbutyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-4-[(3S)-3-phenylbutyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 92581864 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (2R,6R)-4-[(3S)-3-phenylbutyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | C[C@@H](CCN1C[C@H]2CCc3nnc(-c4ccncc4)n3[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C23H27N5/c1-17(18-5-3-2-4-6-18)11-14-27-15-20-7-8-22-25-26-23(28(22)21(20)16-27)19-9-12-24-13-10-19/h2-6,9-10,12-13,17,20-21H,7-8,11,14-16H2,1H3/t17-,20+,21-/m0/s1 |
| InChIKey | ZTMUFQCCNWOSIC-WMQCIHAUSA-N |
| XLogP | 3.95 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |