C22H28ClN3O2 — CID 9258253
(2S)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 9258253) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is (2S)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9258253 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (2S)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)[C@H](C)N2CCN(Cc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-17(22(27)24-15-18-6-8-21(28-2)9-7-18)26-12-10-25(11-13-26)16-19-4-3-5-20(23)14-19/h3-9,14,17H,10-13,15-16H2,1-2H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | OIHFKWHKFUMQSQ-KRWDZBQOSA-N |
| XLogP | 3.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |