C21H29FN2O — CID 92583514
[(3R,3aS,9aR)-3-(3-fluorophenyl)-1-methyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-4-yl]-[(1R,2S)-2-methylcyclopropyl]methanone (PubChem CID 92583514) has the molecular formula C21H29FN2O and a molecular weight of 344.47 g/mol. Its IUPAC name is [(3R,3aS,9aR)-3-(3-fluorophenyl)-1-methyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-4-yl]-[(1R,2S)-2-methylcyclopropyl]methanone.
| Compound Name | [(3R,3aS,9aR)-3-(3-fluorophenyl)-1-methyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-4-yl]-[(1R,2S)-2-methylcyclopropyl]methanone |
|---|---|
| PubChem CID | 92583514 |
| Molecular Formula | C21H29FN2O |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | [(3R,3aS,9aR)-3-(3-fluorophenyl)-1-methyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-4-yl]-[(1R,2S)-2-methylcyclopropyl]methanone |
| SMILES | C[C@H]1C[C@H]1C(=O)N1CCCCC[C@@H]2[C@@H]1[C@H](c1cccc(F)c1)CN2C |
| InChI | InChI=1S/C21H29FN2O/c1-14-11-17(14)21(25)24-10-5-3-4-9-19-20(24)18(13-23(19)2)15-7-6-8-16(22)12-15/h6-8,12,14,17-20H,3-5,9-11,13H2,1-2H3/t14-,17+,18-,19+,20-/m0/s1 |
| InChIKey | LIADLCRLGJFXFF-AXBXVSCFSA-N |
| XLogP | 3.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |