C22H30N4O — CID 92583939
1-[4-(3-aminoquinolin-2-yl)piperidin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone (PubChem CID 92583939) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[4-(3-aminoquinolin-2-yl)piperidin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 1-[4-(3-aminoquinolin-2-yl)piperidin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 92583939 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-[4-(3-aminoquinolin-2-yl)piperidin-1-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@@H]1CCCCN1CC(=O)N1CCC(c2nc3ccccc3cc2N)CC1 |
| InChI | InChI=1S/C22H30N4O/c1-16-6-4-5-11-26(16)15-21(27)25-12-9-17(10-13-25)22-19(23)14-18-7-2-3-8-20(18)24-22/h2-3,7-8,14,16-17H,4-6,9-13,15,23H2,1H3/t16-/m1/s1 |
| InChIKey | BBLAZTQPRHNJLW-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |