C25H32FN3O — CID 92584365
N-[1-[[(2S)-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl]methyl]-4-(4-fluorophenyl)piperidin-4-yl]acetamide (PubChem CID 92584365) has the molecular formula C25H32FN3O and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[1-[[(2S)-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl]methyl]-4-(4-fluorophenyl)piperidin-4-yl]acetamide.
| Compound Name | N-[1-[[(2S)-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl]methyl]-4-(4-fluorophenyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 92584365 |
| Molecular Formula | C25H32FN3O |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-[1-[[(2S)-1,2-dimethyl-3,4-dihydro-2H-quinolin-6-yl]methyl]-4-(4-fluorophenyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1(c2ccc(F)cc2)CCN(Cc2ccc3c(c2)CC[C@H](C)N3C)CC1 |
| InChI | InChI=1S/C25H32FN3O/c1-18-4-6-21-16-20(5-11-24(21)28(18)3)17-29-14-12-25(13-15-29,27-19(2)30)22-7-9-23(26)10-8-22/h5,7-11,16,18H,4,6,12-15,17H2,1-3H3,(H,27,30)/t18-/m0/s1 |
| InChIKey | BEPFDYGEPVSXGF-SFHVURJKSA-N |
| XLogP | 4.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|