C24H26N2O5 — CID 9258574
N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide (PubChem CID 9258574) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide.
| Compound Name | N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide |
|---|---|
| PubChem CID | 9258574 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide |
| SMILES | CC(C)[C@H](NC(=O)CCN1C(=O)Cc2ccccc2C1=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H26N2O5/c1-15(2)23(17-7-8-19-20(13-17)31-12-11-30-19)25-21(27)9-10-26-22(28)14-16-5-3-4-6-18(16)24(26)29/h3-8,13,15,23H,9-12,14H2,1-2H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | TVOGOEQFEPHIGC-QHCPKHFHSA-N |
| XLogP | 2.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|