C26H33N3O2 — CID 92587244
(6R)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)-4-propyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 92587244) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (6R)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)-4-propyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | (6R)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)-4-propyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92587244 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (6R)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)-4-propyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | CCCN1CCN(CC2=CCCOC2)C[C@@H](Cc2ccccc2-c2cccnc2)C1=O |
| InChI | InChI=1S/C26H33N3O2/c1-2-12-29-14-13-28(18-21-7-6-15-31-20-21)19-24(26(29)30)16-22-8-3-4-10-25(22)23-9-5-11-27-17-23/h3-5,7-11,17,24H,2,6,12-16,18-20H2,1H3/t24-/m1/s1 |
| InChIKey | XTLXJQFAZNSOPN-XMMPIXPASA-N |
| XLogP | 3.81 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|