C24H34N4O — CID 92588172
[(3R,3aS,9aR)-4-methyl-3-phenyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-(5-ethyl-2,4-dimethylpyrazol-3-yl)methanone (PubChem CID 92588172) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is [(3R,3aS,9aR)-4-methyl-3-phenyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-(5-ethyl-2,4-dimethylpyrazol-3-yl)methanone.
| Compound Name | [(3R,3aS,9aR)-4-methyl-3-phenyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-(5-ethyl-2,4-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 92588172 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [(3R,3aS,9aR)-4-methyl-3-phenyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-(5-ethyl-2,4-dimethylpyrazol-3-yl)methanone |
| SMILES | CCc1nn(C)c(C(=O)N2C[C@@H](c3ccccc3)[C@H]3[C@H]2CCCCCN3C)c1C |
| InChI | InChI=1S/C24H34N4O/c1-5-20-17(2)22(27(4)25-20)24(29)28-16-19(18-12-8-6-9-13-18)23-21(28)14-10-7-11-15-26(23)3/h6,8-9,12-13,19,21,23H,5,7,10-11,14-16H2,1-4H3/t19-,21+,23-/m0/s1 |
| InChIKey | ZDGHKGQASDCYNQ-WPYKKVEZSA-N |
| XLogP | 3.77 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |