C18H16ClN3OS — CID 9259084
N-[2-(4-chlorophenyl)sulfanylethyl]-4-pyrazol-1-ylbenzamide (PubChem CID 9259084) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-4-pyrazol-1-ylbenzamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 9259084 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-pyrazol-1-ylbenzamide |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C18H16ClN3OS/c19-15-4-8-17(9-5-15)24-13-11-20-18(23)14-2-6-16(7-3-14)22-12-1-10-21-22/h1-10,12H,11,13H2,(H,20,23) |
| InChIKey | AORRXRBIJWIQKA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|