C24H32N4O2S — CID 92590981
(3aR,11aR)-10-[2-(diethylamino)ethyl]-3a-methyl-2-(thiophen-3-ylmethyl)-1,3,4,11a-tetrahydropyrrolo[3,4-c][1,5]benzodiazocine-5,11-dione (PubChem CID 92590981) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is (3aR,11aR)-10-[2-(diethylamino)ethyl]-3a-methyl-2-(thiophen-3-ylmethyl)-1,3,4,11a-tetrahydropyrrolo[3,4-c][1,5]benzodiazocine-5,11-dione.
| Compound Name | (3aR,11aR)-10-[2-(diethylamino)ethyl]-3a-methyl-2-(thiophen-3-ylmethyl)-1,3,4,11a-tetrahydropyrrolo[3,4-c][1,5]benzodiazocine-5,11-dione |
|---|---|
| PubChem CID | 92590981 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3aR,11aR)-10-[2-(diethylamino)ethyl]-3a-methyl-2-(thiophen-3-ylmethyl)-1,3,4,11a-tetrahydropyrrolo[3,4-c][1,5]benzodiazocine-5,11-dione |
| SMILES | CCN(CC)CCN1C(=O)[C@@H]2CN(Cc3ccsc3)C[C@]2(C)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H32N4O2S/c1-4-26(5-2)11-12-28-21-9-7-6-8-19(21)22(29)25-24(3)17-27(15-20(24)23(28)30)14-18-10-13-31-16-18/h6-10,13,16,20H,4-5,11-12,14-15,17H2,1-3H3,(H,25,29)/t20-,24-/m0/s1 |
| InChIKey | OGXKAQLVFUZXQY-RDPSFJRHSA-N |
| XLogP | 3.06 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |