C26H30N4O3 — CID 92591087
5-[1-(2-ethoxybenzoyl)piperidin-4-yl]-N-ethyl-N-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 92591087) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 5-[1-(2-ethoxybenzoyl)piperidin-4-yl]-N-ethyl-N-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[1-(2-ethoxybenzoyl)piperidin-4-yl]-N-ethyl-N-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 92591087 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 5-[1-(2-ethoxybenzoyl)piperidin-4-yl]-N-ethyl-N-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | CCOc1ccccc1C(=O)N1CCC(c2[nH]ncc2C(=O)N(CC)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N4O3/c1-3-30(20-10-6-5-7-11-20)26(32)22-18-27-28-24(22)19-14-16-29(17-15-19)25(31)21-12-8-9-13-23(21)33-4-2/h5-13,18-19H,3-4,14-17H2,1-2H3,(H,27,28) |
| InChIKey | HFLAUAKSJVLKIO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |