C27H29N3O2 — CID 92592317
(3S)-N-ethyl-3-[(3-phenylphenyl)methyl]-1-(2-pyridin-2-ylacetyl)pyrrolidine-3-carboxamide (PubChem CID 92592317) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (3S)-N-ethyl-3-[(3-phenylphenyl)methyl]-1-(2-pyridin-2-ylacetyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-ethyl-3-[(3-phenylphenyl)methyl]-1-(2-pyridin-2-ylacetyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92592317 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (3S)-N-ethyl-3-[(3-phenylphenyl)methyl]-1-(2-pyridin-2-ylacetyl)pyrrolidine-3-carboxamide |
| SMILES | CCNC(=O)[C@@]1(Cc2cccc(-c3ccccc3)c2)CCN(C(=O)Cc2ccccn2)C1 |
| InChI | InChI=1S/C27H29N3O2/c1-2-28-26(32)27(14-16-30(20-27)25(31)18-24-13-6-7-15-29-24)19-21-9-8-12-23(17-21)22-10-4-3-5-11-22/h3-13,15,17H,2,14,16,18-20H2,1H3,(H,28,32)/t27-/m1/s1 |
| InChIKey | AMZXFYMIUSBAIS-HHHXNRCGSA-N |
| XLogP | 3.89 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |