C12H19NO2 — CID 92592936
ethyl (5aS,8aS)-2,5,6,7,8,8a-hexahydro-1H-cyclopenta[b]azepine-5a-carboxylate (PubChem CID 92592936) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethyl (5aS,8aS)-2,5,6,7,8,8a-hexahydro-1H-cyclopenta[b]azepine-5a-carboxylate.
| Compound Name | ethyl (5aS,8aS)-2,5,6,7,8,8a-hexahydro-1H-cyclopenta[b]azepine-5a-carboxylate |
|---|---|
| PubChem CID | 92592936 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethyl (5aS,8aS)-2,5,6,7,8,8a-hexahydro-1H-cyclopenta[b]azepine-5a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC=CCN[C@H]1CCC2 |
| InChI | InChI=1S/C12H19NO2/c1-2-15-11(14)12-7-3-4-9-13-10(12)6-5-8-12/h3-4,10,13H,2,5-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | HZRXQOZZQMSECJ-CMPLNLGQSA-N |
| XLogP | 1.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|