C18H20N2O5 — CID 92592965
ethyl 3-[[(3R,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carbonyl]amino]propanoate (PubChem CID 92592965) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is ethyl 3-[[(3R,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(3R,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 92592965 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl 3-[[(3R,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)[C@@H]1[C@@H]2C(=O)Nc3ccccc3C(=O)[C@]12C |
| InChI | InChI=1S/C18H20N2O5/c1-3-25-12(21)8-9-19-16(23)13-14-17(24)20-11-7-5-4-6-10(11)15(22)18(13,14)2/h4-7,13-14H,3,8-9H2,1-2H3,(H,19,23)(H,20,24)/t13-,14+,18+/m0/s1 |
| InChIKey | UGEYTCXHVHLTNY-PMUMKWKESA-N |
| XLogP | 1.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |