C22H35N3O3 — CID 92593329
(3aS,4S,6aR)-2-(cyclohexylmethyl)-4-(2,4-diethoxypyrimidin-5-yl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 92593329) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-(cyclohexylmethyl)-4-(2,4-diethoxypyrimidin-5-yl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-2-(cyclohexylmethyl)-4-(2,4-diethoxypyrimidin-5-yl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 92593329 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | (3aS,4S,6aR)-2-(cyclohexylmethyl)-4-(2,4-diethoxypyrimidin-5-yl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | CCOc1ncc([C@]2(O)CC[C@H]3CN(CC4CCCCC4)C[C@H]32)c(OCC)n1 |
| InChI | InChI=1S/C22H35N3O3/c1-3-27-20-18(12-23-21(24-20)28-4-2)22(26)11-10-17-14-25(15-19(17)22)13-16-8-6-5-7-9-16/h12,16-17,19,26H,3-11,13-15H2,1-2H3/t17-,19+,22+/m0/s1 |
| InChIKey | MOHBQOMDTQYSON-LRXVAGHRSA-N |
| XLogP | 3.38 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |