C21H23N3O4 — CID 92594426
3-[(4-hydroxyphenyl)methyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one (PubChem CID 92594426) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one.
| Compound Name | 3-[(4-hydroxyphenyl)methyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 92594426 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one |
| SMILES | COc1cc2nc3n(c(=O)c2cc1OC)CCN(Cc1ccc(O)cc1)CC3 |
| InChI | InChI=1S/C21H23N3O4/c1-27-18-11-16-17(12-19(18)28-2)22-20-7-8-23(9-10-24(20)21(16)26)13-14-3-5-15(25)6-4-14/h3-6,11-12,25H,7-10,13H2,1-2H3 |
| InChIKey | CADBFEWTPFAUJL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |