C21H26N4O3 — CID 92594485
(2,5-dimethoxyphenyl)-[(3S)-3-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methanone (PubChem CID 92594485) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-[(3S)-3-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methanone.
| Compound Name | (2,5-dimethoxyphenyl)-[(3S)-3-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92594485 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2,5-dimethoxyphenyl)-[(3S)-3-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(OC)c(C(=O)N2CCC[C@H](c3ncc4c(n3)CCNC4)C2)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-27-16-5-6-19(28-2)17(10-16)21(26)25-9-3-4-14(13-25)20-23-12-15-11-22-8-7-18(15)24-20/h5-6,10,12,14,22H,3-4,7-9,11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | MKGUKZJLQAWEAQ-AWEZNQCLSA-N |
| XLogP | 2.16 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |