C26H27N3O4 — CID 92594502
(6R)-1-(2,5-dimethoxybenzoyl)-6-[(2-pyridin-4-ylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 92594502) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (6R)-1-(2,5-dimethoxybenzoyl)-6-[(2-pyridin-4-ylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | (6R)-1-(2,5-dimethoxybenzoyl)-6-[(2-pyridin-4-ylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92594502 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (6R)-1-(2,5-dimethoxybenzoyl)-6-[(2-pyridin-4-ylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | COc1ccc(OC)c(C(=O)N2CCNC(=O)[C@H](Cc3ccccc3-c3ccncc3)C2)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-32-21-7-8-24(33-2)23(16-21)26(31)29-14-13-28-25(30)20(17-29)15-19-5-3-4-6-22(19)18-9-11-27-12-10-18/h3-12,16,20H,13-15,17H2,1-2H3,(H,28,30)/t20-/m1/s1 |
| InChIKey | GQURTZKZKMLSCX-HXUWFJFHSA-N |
| XLogP | 3.20 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |