C21H22N2O4S — CID 92595363
(3S)-1-[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-yl]piperidin-3-ol (PubChem CID 92595363) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is (3S)-1-[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-yl]piperidin-3-ol.
| Compound Name | (3S)-1-[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 92595363 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (3S)-1-[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-yl]piperidin-3-ol |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(N3CCC[C@H](O)C3)=NS2(=O)=O)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-27-18-11-9-16(10-12-18)20-19(15-6-3-2-4-7-15)21(22-28(20,25)26)23-13-5-8-17(24)14-23/h2-4,6-7,9-12,17,24H,5,8,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | GYEQIIZGDMDTMM-KRWDZBQOSA-N |
| XLogP | 2.76 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|