C19H23FN2O — CID 92595912
(2S,3R)-2-(2-fluorophenyl)-1-[(4-methoxyphenyl)methyl]piperidin-3-amine (PubChem CID 92595912) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is (2S,3R)-2-(2-fluorophenyl)-1-[(4-methoxyphenyl)methyl]piperidin-3-amine.
| Compound Name | (2S,3R)-2-(2-fluorophenyl)-1-[(4-methoxyphenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 92595912 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (2S,3R)-2-(2-fluorophenyl)-1-[(4-methoxyphenyl)methyl]piperidin-3-amine |
| SMILES | COc1ccc(CN2CCC[C@@H](N)[C@@H]2c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H23FN2O/c1-23-15-10-8-14(9-11-15)13-22-12-4-7-18(21)19(22)16-5-2-3-6-17(16)20/h2-3,5-6,8-11,18-19H,4,7,12-13,21H2,1H3/t18-,19+/m1/s1 |
| InChIKey | SZRWYSWDPANRDT-MOPGFXCFSA-N |
| XLogP | 3.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |