C25H26N2O3S — CID 92599380
(3S)-1-(3-methoxybenzoyl)-3-[(2-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 92599380) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is (3S)-1-(3-methoxybenzoyl)-3-[(2-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(3-methoxybenzoyl)-3-[(2-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92599380 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (3S)-1-(3-methoxybenzoyl)-3-[(2-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1cccc(C(=O)N2CCC[C@@](Cc3ccccc3-c3cccs3)(C(N)=O)C2)c1 |
| InChI | InChI=1S/C25H26N2O3S/c1-30-20-9-4-8-18(15-20)23(28)27-13-6-12-25(17-27,24(26)29)16-19-7-2-3-10-21(19)22-11-5-14-31-22/h2-5,7-11,14-15H,6,12-13,16-17H2,1H3,(H2,26,29)/t25-/m0/s1 |
| InChIKey | KGYREYVPASDUKD-VWLOTQADSA-N |
| XLogP | 4.37 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |