C27H33N3O2+2 — CID 9259983
N-(2-benzylphenyl)-2-[4-(2-phenoxyethyl)piperazine-1,4-diium-1-yl]acetamide (PubChem CID 9259983) has the molecular formula C27H33N3O2+2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-[4-(2-phenoxyethyl)piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | N-(2-benzylphenyl)-2-[4-(2-phenoxyethyl)piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 9259983 |
| Molecular Formula | C27H33N3O2+2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-(2-benzylphenyl)-2-[4-(2-phenoxyethyl)piperazine-1,4-diium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](CCOc2ccccc2)CC1)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C27H31N3O2/c31-27(28-26-14-8-7-11-24(26)21-23-9-3-1-4-10-23)22-30-17-15-29(16-18-30)19-20-32-25-12-5-2-6-13-25/h1-14H,15-22H2,(H,28,31)/p+2 |
| InChIKey | ZAUOSMISULIAOR-UHFFFAOYSA-P |
| XLogP | 1.08 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |