C25H32N2O3 — CID 92600957
(3S,7R,8aS)-3-benzyl-2-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 92600957) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (3S,7R,8aS)-3-benzyl-2-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3S,7R,8aS)-3-benzyl-2-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 92600957 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (3S,7R,8aS)-3-benzyl-2-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | C=CCOc1c(CN2C[C@@H]3C[C@@H](O)CN3C[C@@H]2Cc2ccccc2)cccc1OC |
| InChI | InChI=1S/C25H32N2O3/c1-3-12-30-25-20(10-7-11-24(25)29-2)15-26-17-22-14-23(28)18-27(22)16-21(26)13-19-8-5-4-6-9-19/h3-11,21-23,28H,1,12-18H2,2H3/t21-,22-,23+/m0/s1 |
| InChIKey | UWBSWBJJLRJJKE-RJGXRXQPSA-N |
| XLogP | 3.12 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|