C22H24N2O3 — CID 92601337
(3R)-1-cyclopropyl-N-[(S)-(2-methoxyphenyl)-phenylmethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 92601337) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3R)-1-cyclopropyl-N-[(S)-(2-methoxyphenyl)-phenylmethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-cyclopropyl-N-[(S)-(2-methoxyphenyl)-phenylmethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92601337 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3R)-1-cyclopropyl-N-[(S)-(2-methoxyphenyl)-phenylmethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(C2CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-27-19-10-6-5-9-18(19)21(15-7-3-2-4-8-15)23-22(26)16-13-20(25)24(14-16)17-11-12-17/h2-10,16-17,21H,11-14H2,1H3,(H,23,26)/t16-,21+/m1/s1 |
| InChIKey | OOYFLFAYSBPQEA-IERDGZPVSA-N |
| XLogP | 2.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |