C25H23FN4O2 — CID 92601561
N-[2-[3-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-1-yl]ethyl]-2-(2-methoxyphenyl)acetamide (PubChem CID 92601561) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is N-[2-[3-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-1-yl]ethyl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[2-[3-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-1-yl]ethyl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 92601561 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[2-[3-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-1-yl]ethyl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)NCCn1nc(-c2ccc(F)cc2)cc1-c1cccnc1 |
| InChI | InChI=1S/C25H23FN4O2/c1-32-24-7-3-2-5-19(24)15-25(31)28-13-14-30-23(20-6-4-12-27-17-20)16-22(29-30)18-8-10-21(26)11-9-18/h2-12,16-17H,13-15H2,1H3,(H,28,31) |
| InChIKey | RVXSIEFDSGUIKK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |