C20H28N2O4S — CID 92603244
(2R)-2-[3-[4-(3-methylsulfonyl-2-pyridinyl)piperidin-1-yl]-3-oxopropyl]cyclohexan-1-one (PubChem CID 92603244) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is (2R)-2-[3-[4-(3-methylsulfonyl-2-pyridinyl)piperidin-1-yl]-3-oxopropyl]cyclohexan-1-one.
| Compound Name | (2R)-2-[3-[4-(3-methylsulfonyl-2-pyridinyl)piperidin-1-yl]-3-oxopropyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 92603244 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (2R)-2-[3-[4-(3-methylsulfonyl-2-pyridinyl)piperidin-1-yl]-3-oxopropyl]cyclohexan-1-one |
| SMILES | CS(=O)(=O)c1cccnc1C1CCN(C(=O)CC[C@H]2CCCCC2=O)CC1 |
| InChI | InChI=1S/C20H28N2O4S/c1-27(25,26)18-7-4-12-21-20(18)16-10-13-22(14-11-16)19(24)9-8-15-5-2-3-6-17(15)23/h4,7,12,15-16H,2-3,5-6,8-11,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | SHAVOHMZJRLCDA-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |