C19H24FN3O — CID 92604104
(3S,7R,8aR)-2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 92604104) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is (3S,7R,8aR)-2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3S,7R,8aR)-2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 92604104 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (3S,7R,8aR)-2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | C[C@H]1CN2C[C@H](O)C[C@@H]2CN1Cc1cccn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FN3O/c1-14-10-22-13-19(24)9-18(22)12-21(14)11-17-3-2-8-23(17)16-6-4-15(20)5-7-16/h2-8,14,18-19,24H,9-13H2,1H3/t14-,18+,19+/m0/s1 |
| InChIKey | YUCPVUGLAQGFPN-GDIGMMSISA-N |
| XLogP | 2.26 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |