C21H29N3O4 — CID 92604135
(1R,2S,3R)-3-(2-aminobenzoyl)-2-N,2-N,3-trimethyl-1-N-(oxan-4-ylmethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 92604135) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is (1R,2S,3R)-3-(2-aminobenzoyl)-2-N,2-N,3-trimethyl-1-N-(oxan-4-ylmethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | (1R,2S,3R)-3-(2-aminobenzoyl)-2-N,2-N,3-trimethyl-1-N-(oxan-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 92604135 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (1R,2S,3R)-3-(2-aminobenzoyl)-2-N,2-N,3-trimethyl-1-N-(oxan-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CN(C)C(=O)[C@H]1[C@@H](C(=O)NCC2CCOCC2)[C@@]1(C)C(=O)c1ccccc1N |
| InChI | InChI=1S/C21H29N3O4/c1-21(18(25)14-6-4-5-7-15(14)22)16(17(21)20(27)24(2)3)19(26)23-12-13-8-10-28-11-9-13/h4-7,13,16-17H,8-12,22H2,1-3H3,(H,23,26)/t16-,17+,21+/m0/s1 |
| InChIKey | IRKPXMXXTWUNJQ-CSODHUTKSA-N |
| XLogP | 1.33 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|