C23H22FN5O2 — CID 92605956
N-[(1S)-1-[7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide (PubChem CID 92605956) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is N-[(1S)-1-[7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide.
| Compound Name | N-[(1S)-1-[7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 92605956 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[(1S)-1-[7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(c1C(=O)N[C@@H](C)c1nc3cc(-c4ccc(F)cc4)ncn3n1)CCCC2 |
| InChI | InChI=1S/C23H22FN5O2/c1-13(26-23(30)21-14(2)31-19-6-4-3-5-17(19)21)22-27-20-11-18(25-12-29(20)28-22)15-7-9-16(24)10-8-15/h7-13H,3-6H2,1-2H3,(H,26,30)/t13-/m0/s1 |
| InChIKey | PKGTVFDOVIHAMX-ZDUSSCGKSA-N |
| XLogP | 4.20 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |