C28H30N2O3 — CID 92606049
(4S)-1'-[(2R)-2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]spiro[3,4-dihydrobenzo[h]chromene-2,4'-piperidine]-4-ol (PubChem CID 92606049) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (4S)-1'-[(2R)-2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]spiro[3,4-dihydrobenzo[h]chromene-2,4'-piperidine]-4-ol.
| Compound Name | (4S)-1'-[(2R)-2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]spiro[3,4-dihydrobenzo[h]chromene-2,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 92606049 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (4S)-1'-[(2R)-2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]spiro[3,4-dihydrobenzo[h]chromene-2,4'-piperidine]-4-ol |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](O)CN1CCC2(CC1)C[C@H](O)c1ccc3ccccc3c1O2 |
| InChI | InChI=1S/C28H30N2O3/c1-18-26(21-8-4-5-9-23(21)29-18)25(32)17-30-14-12-28(13-15-30)16-24(31)22-11-10-19-6-2-3-7-20(19)27(22)33-28/h2-11,24-25,29,31-32H,12-17H2,1H3/t24-,25-/m0/s1 |
| InChIKey | SNFHUXMLVXTTSW-DQEYMECFSA-N |
| XLogP | 5.01 |
| TPSA | 68.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|