C19H26N6 — CID 92606668
(1R,9S)-12-[(1,3-dimethylpyrazol-4-yl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 92606668) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is (1R,9S)-12-[(1,3-dimethylpyrazol-4-yl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9S)-12-[(1,3-dimethylpyrazol-4-yl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 92606668 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (1R,9S)-12-[(1,3-dimethylpyrazol-4-yl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1nn(C)cc1CN1[C@H]2CC[C@@H]1c1cnc(N3CCCC3)nc1C2 |
| InChI | InChI=1S/C19H26N6/c1-13-14(11-23(2)22-13)12-25-15-5-6-18(25)16-10-20-19(21-17(16)9-15)24-7-3-4-8-24/h10-11,15,18H,3-9,12H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | YQYQITPHOGJLDL-MAUKXSAKSA-N |
| XLogP | 2.38 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |