C22H28N6O — CID 92607118
2-[4-(dimethylamino)phenyl]-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyridin-1-yl]ethyl]acetamide (PubChem CID 92607118) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyridin-1-yl]ethyl]acetamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyridin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 92607118 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyridin-1-yl]ethyl]acetamide |
| SMILES | CN(C)c1ccc(CC(=O)NCCn2nc([C@H]3CCNC3)c3cccnc32)cc1 |
| InChI | InChI=1S/C22H28N6O/c1-27(2)18-7-5-16(6-8-18)14-20(29)24-12-13-28-22-19(4-3-10-25-22)21(26-28)17-9-11-23-15-17/h3-8,10,17,23H,9,11-15H2,1-2H3,(H,24,29)/t17-/m0/s1 |
| InChIKey | GVURVXJNMXDCRI-KRWDZBQOSA-N |
| XLogP | 1.93 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|