C25H31FN4O2 — CID 92607132
N-[4-(dimethylamino)phenyl]-2-[(4R,5S)-4-(2-fluorophenyl)-7-oxo-2,6-diazaspiro[4.6]undecan-2-yl]acetamide (PubChem CID 92607132) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[(4R,5S)-4-(2-fluorophenyl)-7-oxo-2,6-diazaspiro[4.6]undecan-2-yl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[(4R,5S)-4-(2-fluorophenyl)-7-oxo-2,6-diazaspiro[4.6]undecan-2-yl]acetamide |
|---|---|
| PubChem CID | 92607132 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[(4R,5S)-4-(2-fluorophenyl)-7-oxo-2,6-diazaspiro[4.6]undecan-2-yl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CN2C[C@@H](c3ccccc3F)[C@@]3(CCCCC(=O)N3)C2)cc1 |
| InChI | InChI=1S/C25H31FN4O2/c1-29(2)19-12-10-18(11-13-19)27-24(32)16-30-15-21(20-7-3-4-8-22(20)26)25(17-30)14-6-5-9-23(31)28-25/h3-4,7-8,10-13,21H,5-6,9,14-17H2,1-2H3,(H,27,32)(H,28,31)/t21-,25+/m0/s1 |
| InChIKey | MIICOXRKNGLVLM-SQJMNOBHSA-N |
| XLogP | 3.36 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|