C22H27N3O — CID 92608276
[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-pyridin-2-ylmethanone (PubChem CID 92608276) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 92608276 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-pyridin-2-ylmethanone |
| SMILES | CN1CCCC[C@@H]2[C@H]1[C@@H](c1ccccc1)CCN2C(=O)c1ccccn1 |
| InChI | InChI=1S/C22H27N3O/c1-24-15-8-6-12-20-21(24)18(17-9-3-2-4-10-17)13-16-25(20)22(26)19-11-5-7-14-23-19/h2-5,7,9-11,14,18,20-21H,6,8,12-13,15-16H2,1H3/t18-,20-,21-/m1/s1 |
| InChIKey | LIFAEPUAYBZVHP-HMXCVIKNSA-N |
| XLogP | 3.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |