C23H27N5O — CID 92608279
[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone (PubChem CID 92608279) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone.
| Compound Name | [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 92608279 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone |
| SMILES | CN1CCCC[C@@H]2[C@H]1[C@@H](c1ccccc1)CCN2C(=O)c1cn2cccnc2n1 |
| InChI | InChI=1S/C23H27N5O/c1-26-13-6-5-10-20-21(26)18(17-8-3-2-4-9-17)11-15-28(20)22(29)19-16-27-14-7-12-24-23(27)25-19/h2-4,7-9,12,14,16,18,20-21H,5-6,10-11,13,15H2,1H3/t18-,20-,21-/m1/s1 |
| InChIKey | YTLVWTJJVQJMQX-HMXCVIKNSA-N |
| XLogP | 3.21 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |