C21H22F2N2O — CID 92608310
[(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 92608310) has the molecular formula C21H22F2N2O and a molecular weight of 356.42 g/mol. Its IUPAC name is [(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 92608310 |
| Molecular Formula | C21H22F2N2O |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | CN1CCC[C@@H]2[C@H]1[C@@H](c1ccc(F)cc1)CN2C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H22F2N2O/c1-24-11-3-6-19-20(24)18(14-7-9-16(22)10-8-14)13-25(19)21(26)15-4-2-5-17(23)12-15/h2,4-5,7-10,12,18-20H,3,6,11,13H2,1H3/t18-,19-,20-/m1/s1 |
| InChIKey | NFRSWKFFTTYWDP-VAMGGRTRSA-N |
| XLogP | 3.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |