C22H29FN4O — CID 92608957
2-[(3S)-1-[3-(4-fluorophenoxy)propyl]piperidin-3-yl]-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 92608957) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[(3S)-1-[3-(4-fluorophenoxy)propyl]piperidin-3-yl]-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 2-[(3S)-1-[3-(4-fluorophenoxy)propyl]piperidin-3-yl]-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 92608957 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[(3S)-1-[3-(4-fluorophenoxy)propyl]piperidin-3-yl]-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | CN1CCc2nc([C@H]3CCCN(CCCOc4ccc(F)cc4)C3)ncc2C1 |
| InChI | InChI=1S/C22H29FN4O/c1-26-12-9-21-18(15-26)14-24-22(25-21)17-4-2-10-27(16-17)11-3-13-28-20-7-5-19(23)6-8-20/h5-8,14,17H,2-4,9-13,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | QTNSZJACMOZVDH-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|