C22H25N5O2 — CID 92611238
[(3R)-3-[5-(2-methoxyethylamino)-1,6-naphthyridin-7-yl]piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 92611238) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is [(3R)-3-[5-(2-methoxyethylamino)-1,6-naphthyridin-7-yl]piperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3R)-3-[5-(2-methoxyethylamino)-1,6-naphthyridin-7-yl]piperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 92611238 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [(3R)-3-[5-(2-methoxyethylamino)-1,6-naphthyridin-7-yl]piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | COCCNc1nc([C@@H]2CCCN(C(=O)c3cccnc3)C2)cc2ncccc12 |
| InChI | InChI=1S/C22H25N5O2/c1-29-12-10-25-21-18-7-3-9-24-20(18)13-19(26-21)17-6-4-11-27(15-17)22(28)16-5-2-8-23-14-16/h2-3,5,7-9,13-14,17H,4,6,10-12,15H2,1H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | QXAHVTMCIQIMJE-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|