C20H27N3O5 — CID 92611512
(3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 92611512) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 92611512 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | COCc1ccc(CN2C[C@@H]3CC[C@@](O)(c4cnc(OC)nc4OC)[C@@H]3C2)o1 |
| InChI | InChI=1S/C20H27N3O5/c1-25-12-15-5-4-14(28-15)10-23-9-13-6-7-20(24,17(13)11-23)16-8-21-19(27-3)22-18(16)26-2/h4-5,8,13,17,24H,6-7,9-12H2,1-3H3/t13-,17+,20+/m0/s1 |
| InChIKey | ZXSQORQFDXBSTA-WSXQUGQNSA-N |
| XLogP | 1.96 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |