C20H23ClN4 — CID 92613141
8-chloro-2-[[(3R)-3-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]quinoline (PubChem CID 92613141) has the molecular formula C20H23ClN4 and a molecular weight of 354.89 g/mol. Its IUPAC name is 8-chloro-2-[[(3R)-3-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]quinoline.
| Compound Name | 8-chloro-2-[[(3R)-3-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 92613141 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 8-chloro-2-[[(3R)-3-[(2-methylimidazol-1-yl)methyl]piperidin-1-yl]methyl]quinoline |
| SMILES | Cc1nccn1C[C@@H]1CCCN(Cc2ccc3cccc(Cl)c3n2)C1 |
| InChI | InChI=1S/C20H23ClN4/c1-15-22-9-11-25(15)13-16-4-3-10-24(12-16)14-18-8-7-17-5-2-6-19(21)20(17)23-18/h2,5-9,11,16H,3-4,10,12-14H2,1H3/t16-/m1/s1 |
| InChIKey | IOOQUEHIILYDRO-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |