C21H29N3O3 — CID 92613260
(3R)-N-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 92613260) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (3R)-N-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92613260 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (3R)-N-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | COCCn1c(C)c(C)c2cc(NC(=O)[C@@H]3CC(=O)N(C(C)C)C3)ccc21 |
| InChI | InChI=1S/C21H29N3O3/c1-13(2)24-12-16(10-20(24)25)21(26)22-17-6-7-19-18(11-17)14(3)15(4)23(19)8-9-27-5/h6-7,11,13,16H,8-10,12H2,1-5H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | DVEDJHWXLZFPHP-MRXNPFEDSA-N |
| XLogP | 3.10 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|