C23H23N5O3 — CID 92614339
(6-ethyl-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[(4S)-4-(4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 92614339) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is (6-ethyl-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[(4S)-4-(4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | (6-ethyl-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[(4S)-4-(4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 92614339 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (6-ethyl-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[(4S)-4-(4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CCc1cc(C(=O)N2CCc3[nH]cnc3[C@@H]2c2ccc(OC)cc2)c2c(C)noc2n1 |
| InChI | InChI=1S/C23H23N5O3/c1-4-15-11-17(19-13(2)27-31-22(19)26-15)23(29)28-10-9-18-20(25-12-24-18)21(28)14-5-7-16(30-3)8-6-14/h5-8,11-12,21H,4,9-10H2,1-3H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | GMPIRHWUWTVCBS-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |