C19H24N2O4S — CID 92619469
N-methyl-3-[(2S)-4-(2-propan-2-yloxyacetyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 92619469) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-methyl-3-[(2S)-4-(2-propan-2-yloxyacetyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-methyl-3-[(2S)-4-(2-propan-2-yloxyacetyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 92619469 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-methyl-3-[(2S)-4-(2-propan-2-yloxyacetyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc2ccccc2c1[C@H]1CN(C(=O)COC(C)C)CCO1 |
| InChI | InChI=1S/C19H24N2O4S/c1-12(2)25-11-16(22)21-8-9-24-14(10-21)17-13-6-4-5-7-15(13)26-18(17)19(23)20-3/h4-7,12,14H,8-11H2,1-3H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | SYGVJNDFYDWBKQ-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |