C24H31N5O2 — CID 92619545
4-[2-[[(1S)-cyclohex-3-en-1-yl]methylamino]ethyl]-2-morpholin-4-yl-N-phenylpyrimidine-5-carboxamide (PubChem CID 92619545) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 4-[2-[[(1S)-cyclohex-3-en-1-yl]methylamino]ethyl]-2-morpholin-4-yl-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 4-[2-[[(1S)-cyclohex-3-en-1-yl]methylamino]ethyl]-2-morpholin-4-yl-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 92619545 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 4-[2-[[(1S)-cyclohex-3-en-1-yl]methylamino]ethyl]-2-morpholin-4-yl-N-phenylpyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cnc(N2CCOCC2)nc1CCNC[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C24H31N5O2/c30-23(27-20-9-5-2-6-10-20)21-18-26-24(29-13-15-31-16-14-29)28-22(21)11-12-25-17-19-7-3-1-4-8-19/h1-3,5-6,9-10,18-19,25H,4,7-8,11-17H2,(H,27,30)/t19-/m1/s1 |
| InChIKey | YRHUNWXQQCNTLH-LJQANCHMSA-N |
| XLogP | 3.05 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|