C17H24N6OS — CID 92622300
[3-[(2S)-1-methylpiperidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 92622300) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is [3-[(2S)-1-methylpiperidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [3-[(2S)-1-methylpiperidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 92622300 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [3-[(2S)-1-methylpiperidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1ncsc1C(=O)N1CCc2nnc([C@@H]3CCCCN3C)n2CC1 |
| InChI | InChI=1S/C17H24N6OS/c1-12-15(25-11-18-12)17(24)22-8-6-14-19-20-16(23(14)10-9-22)13-5-3-4-7-21(13)2/h11,13H,3-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | QYPDYBZBMLJJLL-ZDUSSCGKSA-N |
| XLogP | 1.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |