C22H32N6O — CID 92622325
4-[3-methyl-4-[[3-[(2S)-pyrrolidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]phenyl]morpholine (PubChem CID 92622325) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[3-methyl-4-[[3-[(2S)-pyrrolidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]phenyl]morpholine.
| Compound Name | 4-[3-methyl-4-[[3-[(2S)-pyrrolidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 92622325 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[3-methyl-4-[[3-[(2S)-pyrrolidin-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]phenyl]morpholine |
| SMILES | Cc1cc(N2CCOCC2)ccc1CN1CCc2nnc([C@@H]3CCCN3)n2CC1 |
| InChI | InChI=1S/C22H32N6O/c1-17-15-19(27-11-13-29-14-12-27)5-4-18(17)16-26-8-6-21-24-25-22(28(21)10-9-26)20-3-2-7-23-20/h4-5,15,20,23H,2-3,6-14,16H2,1H3/t20-/m0/s1 |
| InChIKey | UQDOJIRIOCYCFG-FQEVSTJZSA-N |
| XLogP | 1.91 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|