C19H28N4O4S — CID 92622486
N-cyclopentyl-6-[1-[2-(methanesulfonamido)acetyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 92622486) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-cyclopentyl-6-[1-[2-(methanesulfonamido)acetyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-6-[1-[2-(methanesulfonamido)acetyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92622486 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-cyclopentyl-6-[1-[2-(methanesulfonamido)acetyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)NCC(=O)N1CCC(c2ccc(C(=O)NC3CCCC3)cn2)CC1 |
| InChI | InChI=1S/C19H28N4O4S/c1-28(26,27)21-13-18(24)23-10-8-14(9-11-23)17-7-6-15(12-20-17)19(25)22-16-4-2-3-5-16/h6-7,12,14,16,21H,2-5,8-11,13H2,1H3,(H,22,25) |
| InChIKey | GBOSDPNOENRKCC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |