C25H42N6O — CID 92623544
1-[(2S)-2-[7-methyl-4-(methylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]piperidin-1-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone (PubChem CID 92623544) has the molecular formula C25H42N6O and a molecular weight of 442.65 g/mol. Its IUPAC name is 1-[(2S)-2-[7-methyl-4-(methylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]piperidin-1-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone.
| Compound Name | 1-[(2S)-2-[7-methyl-4-(methylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]piperidin-1-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 92623544 |
| Molecular Formula | C25H42N6O |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 1-[(2S)-2-[7-methyl-4-(methylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]piperidin-1-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone |
| SMILES | CNc1nc([C@@H]2CCCCN2C(=O)CC2CC(C)(C)NC(C)(C)C2)nc2c1CCN(C)C2 |
| InChI | InChI=1S/C25H42N6O/c1-24(2)14-17(15-25(3,4)29-24)13-21(32)31-11-8-7-9-20(31)23-27-19-16-30(6)12-10-18(19)22(26-5)28-23/h17,20,29H,7-16H2,1-6H3,(H,26,27,28)/t20-/m0/s1 |
| InChIKey | VIEGKRPHYOQAMZ-FQEVSTJZSA-N |
| XLogP | 3.51 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |