C18H19BrFNO3 — CID 9262782
2-(2-bromo-4-fluorophenoxy)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]acetamide (PubChem CID 9262782) has the molecular formula C18H19BrFNO3 and a molecular weight of 396.26 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 9262782 |
| Molecular Formula | C18H19BrFNO3 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C18H19BrFNO3/c1-11-4-6-16(23-3)14(8-11)12(2)21-18(22)10-24-17-7-5-13(20)9-15(17)19/h4-9,12H,10H2,1-3H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | BLVQISIPHKKYHT-GFCCVEGCSA-N |
| XLogP | 4.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |