C21H28N4O — CID 92628553
4-[(2S)-2-[5-(1-prop-2-enyl-2,3-dihydroindol-5-yl)imidazol-1-yl]propyl]morpholine (PubChem CID 92628553) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[(2S)-2-[5-(1-prop-2-enyl-2,3-dihydroindol-5-yl)imidazol-1-yl]propyl]morpholine.
| Compound Name | 4-[(2S)-2-[5-(1-prop-2-enyl-2,3-dihydroindol-5-yl)imidazol-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 92628553 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 4-[(2S)-2-[5-(1-prop-2-enyl-2,3-dihydroindol-5-yl)imidazol-1-yl]propyl]morpholine |
| SMILES | C=CCN1CCc2cc(-c3cncn3[C@@H](C)CN3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H28N4O/c1-3-7-24-8-6-19-13-18(4-5-20(19)24)21-14-22-16-25(21)17(2)15-23-9-11-26-12-10-23/h3-5,13-14,16-17H,1,6-12,15H2,2H3/t17-/m0/s1 |
| InChIKey | OQJFOQOMATVBOK-KRWDZBQOSA-N |
| XLogP | 2.99 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|